| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- FMOC-ASP(OALL)-OH
-
- $1.00
-
2019-07-06
- CAS:146982-24-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
- FMOC-ASP(OALL)-OH
-
- $7.00
-
2019-07-06
- CAS: 146982-24-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | Fmoc-Asp(OAll)-OH Chemical Properties |
| Melting point | 111-115 °C | | Boiling point | 638.5±55.0 °C(Predicted) | | density | 1.286±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in water or 1% acetic acid | | form | Solid | | pka | 3.59±0.23(Predicted) | | color | White to off-white | | Optical Rotation | [α]20/D 27±2°, c = 1% in DMF | | Water Solubility | Slightly soluble in water. | | BRN | 6670219 | | Major Application | peptide synthesis | | InChI | 1S/C22H21NO6/c1-2-11-28-20(24)12-19(21(25)26)23-22(27)29-13-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h2-10,18-19H,1,11-13H2,(H,23,27)(H,25,26)/t19-/m0/s1 | | InChIKey | FBNFRRNBFASDKS-IBGZPJMESA-N | | SMILES | OC(=O)[C@H](CC(=O)OCC=C)NC(=O)OCC1c2ccccc2-c3ccccc13 | | CAS DataBase Reference | 146982-24-3(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Asp(OAll)-OH Usage And Synthesis |
| Preparation | 1. In a three-necked flask, tetrahydrofuran and aspartic acid were mixed, and phosphorus oxychloride was added dropwise at low temperature. After reacting for 6 hours, the mixture was filtered to obtain a solid intermediate. 2. The solid intermediate was washed with anhydrous diethyl ether, dried, and then reacted with allyl alcohol, controlling the temperature and time. After the reaction, the pH was adjusted to 7 with triethylamine to precipitate the solid. 3. The solid was washed with diethyl ether and dried to obtain intermediate L-Asp-0A11. 4. L-Asp-0A11 was dissolved in sodium bicarbonate solution, and acetone and Fmoc-0Su were added. The pH was controlled at around 9, and the reaction was carried out at low temperature for 3 hours. 5. After the reaction, the product was washed with anhydrous diethyl ether, extracted with ethyl acetate, and concentrated to dryness after acidification, washing, and drying. 6. Finally, the target product, FMOC-ASP(OALL)-OH, was obtained by crystallization with petroleum ether. | | Chemical Properties | White crystalline powder | | Uses | Fmoc-Asp(OAll)-OH, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Asp(OAll)-OH Preparation Products And Raw materials |
|