Naphthalene, 1-broMo-2-phenyl- manufacturers
|
| | Naphthalene, 1-broMo-2-phenyl- Basic information |
| Product Name: | Naphthalene, 1-broMo-2-phenyl- | | Synonyms: | Naphthalene, 1-broMo-2-phenyl-;1-Bromo-2-phenylnaphthalene >1-Bromo-2-phenylnaphthalene;2-Phenyl-1-bromonaphthalene;1-Bromo-2-phenyInaphthaIene | | CAS: | 22082-93-5 | | MF: | C16H11Br | | MW: | 283.16 | | EINECS: | | | Product Categories: | | | Mol File: | 22082-93-5.mol |  |
| | Naphthalene, 1-broMo-2-phenyl- Chemical Properties |
| Melting point | 63.0 to 67.0 °C | | Boiling point | 170°C/0.2mmHg(lit.) | | density | 1.381±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C16H11Br/c17-16-14-9-5-4-8-13(14)10-11-15(16)12-6-2-1-3-7-12/h1-11H | | InChIKey | ANKXTSUKPPHQJR-UHFFFAOYSA-N | | SMILES | C1(Br)=C2C(C=CC=C2)=CC=C1C1=CC=CC=C1 |
| | Naphthalene, 1-broMo-2-phenyl- Usage And Synthesis |
| | Naphthalene, 1-broMo-2-phenyl- Preparation Products And Raw materials |
|