|
|
| | 9,9,- Bis(3,4-dihydroxyphenyl)fluorene Basic information |
| Product Name: | 9,9,- Bis(3,4-dihydroxyphenyl)fluorene | | Synonyms: | 9,9,- Bis(3,4-dihydroxyphenyl)fluorene;1,2-Benzenediol, 4,4'-(9H-fluoren-9-ylidene)bis-;9,9-bis(3,4-dihydroxypheny)fluorene;4,4'-(9H-Fluorene-9,9-diyl)bis(benzene-1,2-diol);4,4-(9H-Fluorene-9,9-diyl)di(1,2-benzenediol);4-[9-(3,4-dihydroxyphenyl)fluoren-9-yl]benzene-1,2-diol;9,9-Bis(3,4-dihydroxyphenyl)fluorene
(BHPF);4,4'-(9H-Fluorene-9,9-diyl)di(1,2-benzenediol) | | CAS: | 351521-78-3 | | MF: | C25H18O4 | | MW: | 382.41 | | EINECS: | | | Product Categories: | | | Mol File: | 351521-78-3.mol |  |
| | 9,9,- Bis(3,4-dihydroxyphenyl)fluorene Chemical Properties |
| Melting point | 181.0 to 185.0 °C | | Boiling point | 611.4±55.0 °C(Predicted) | | density | 1.422±0.06 g/cm3 (20 ºC 760 Torr) | | pka | 9.31±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C25H18O4/c26-21-11-9-15(13-23(21)28)25(16-10-12-22(27)24(29)14-16)19-7-3-1-5-17(19)18-6-2-4-8-20(18)25/h1-14,26-29H | | InChIKey | RAIOQXXWEGZKAI-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(O)C(O)=C2)(C2=CC=C(O)C(O)=C2)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| | 9,9,- Bis(3,4-dihydroxyphenyl)fluorene Usage And Synthesis |
| Materials Uses | 9,9,- Bis(3,4-dihydroxyphenyl)fluorene (BDPF) is a kind of LCD, OLED intermediate. |
| | 9,9,- Bis(3,4-dihydroxyphenyl)fluorene Preparation Products And Raw materials |
|