| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | L-Serine-13C3 Basic information |
| Product Name: | L-Serine-13C3 | | Synonyms: | L-SERINE (13C3, 99%);L-Serine-13C3;L-Serine (13C?, 99%);L-Serine-13C3;L-Serine-13C3 (Standard) | | CAS: | 201595-68-8 | | MF: | C3H7NO3 | | MW: | 105.09258 | | EINECS: | | | Product Categories: | | | Mol File: | 201595-68-8.mol |  |
| | L-Serine-13C3 Chemical Properties |
| Melting point | >180°C (dec.) | | storage temp. | Refrigerator | | solubility | Methanol (Very Slightly), Water (Slightly, Sonicated) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D +14.6°, c =2 in 1 M HCl | | Water Solubility | Water: slightly, sonicated | | InChI | 1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1/i1+1,2+1,3+1 | | InChIKey | MTCFGRXMJLQNBG-GCCOVPGMSA-N | | SMILES | N[13C@@H]([13CH2]O)[13C](O)=O | | CAS Number Unlabeled | 56-45-1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-Serine-13C3 Usage And Synthesis |
| Uses | L-Serine-13C3 is the isotope labelled analog of L-Serine (S270995); a compound used in the synthesis of purines and pyrimidines as antibacterial/antifungal agents, as well as acting as a proteinogenic compound. |
| | L-Serine-13C3 Preparation Products And Raw materials |
|