| Company Name: |
Jinan Kewei Biotechnology Co., LTD Gold
|
| Tel: |
15315592897 |
| Email: |
xmxingbjlg@163.com |
| Products Intro: |
Product Name:methyl 2-cyano-3-oxobutanoate
CAS:3288-52-6
Purity:97+% Package:1g
|
|
| | MFCD22689506 Basic information |
| Product Name: | MFCD22689506 | | Synonyms: | methyl 2-cyano-3-oxobutanoate;MFCD22689506;Butanoic acid, 2-cyano-3-oxo-, methyl ester;Methyl acetylcyanoacetate | | CAS: | 3288-52-6 | | MF: | C6H7NO3 | | MW: | 141.12 | | EINECS: | | | Product Categories: | | | Mol File: | 3288-52-6.mol |  |
| | MFCD22689506 Chemical Properties |
| Boiling point | 201.9±20.0 °C(Predicted) | | density | 1.157±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, sealed storage, away from moisture | | pka | 4.56±0.46(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C6H7NO3/c1-4(8)5(3-7)6(9)10-2/h5H,1-2H3 | | InChIKey | RJEUAEFRQVZQJY-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(C#N)C(=O)C |
| | MFCD22689506 Usage And Synthesis |
| | MFCD22689506 Preparation Products And Raw materials |
|