| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Terephthalbis(4-fluoroaniline) Basic information |
| | Terephthalbis(4-fluoroaniline) Chemical Properties |
| Melting point | 151-155 °C(lit.) | | Boiling point | 464.8±40.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | pka | 2.32±0.50(Predicted) | | form | solid | | InChI | 1S/C20H14F2N2/c21-17-5-9-19(10-6-17)23-13-15-1-2-16(4-3-15)14-24-20-11-7-18(22)8-12-20/h1-14H/b23-13+,24-14+ | | InChIKey | VBCDABROGMPOGB-RNIAWFEPSA-N | | SMILES | Fc1ccc(cc1)\N=C\c2ccc(cc2)\C=N\c3ccc(F)cc3 |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2921420090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Terephthalbis(4-fluoroaniline) Usage And Synthesis |
| | Terephthalbis(4-fluoroaniline) Preparation Products And Raw materials |
|