| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 18918157536; |
| Email: |
sales8178@energy-chemical.com |
|
| | trans-Dibromobis(triphenylphosphine)- Basic information |
| | trans-Dibromobis(triphenylphosphine)- Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Soluble in chloroform, toluene and benzene | | form | Powder | | color | yellow | | Sensitive | Hygroscopic | | InChI | 1S/2C18H15P.2BrH.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+2/p-2 | | InChIKey | MCSDDEAMPOYJJI-UHFFFAOYSA-L | | SMILES | Br[Pd]Br.c1ccc(cc1)P(c2ccccc2)c3ccccc3.c4ccc(cc4)P(c5ccccc5)c6ccccc6 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | trans-Dibromobis(triphenylphosphine)- Usage And Synthesis |
| Chemical Properties | orange solid | | Uses | Catalyst for:
- Equilibrium palladation of alkanes and arenes and functionalization of hydrocarbons
Reactant for:
- Homocoupling reactions induced by P-C reductive elimination
- Preparation of palladium imidazolylidene complexes via Suzuki coupling reactions
| | reaction suitability | core: palladium
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
| | trans-Dibromobis(triphenylphosphine)- Preparation Products And Raw materials |
|