| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
[4,4',4'',4'''-[Pyrene-1,3,6,8-tetrayltetrakis(ethyne-2,1-diyl)]tetraaniline] manufacturers
|
| | [4,4',4'',4'''-[Pyrene-1,3,6,8-tetrayltetrakis(ethyne-2,1-diyl)]tetraaniline] Basic information |
| Product Name: | [4,4',4'',4'''-[Pyrene-1,3,6,8-tetrayltetrakis(ethyne-2,1-diyl)]tetraaniline] | | Synonyms: | [4,4',4'',4'''-[Pyrene-1,3,6,8-tetrayltetrakis(ethyne-2,1-diyl)]tetraaniline];4,4',4'',4'''-[PYRENE-1,3,6,8-TETRAYLTETRAKIS(ETHYNE-2,1-DIYL)]TETRNANILINE;Benzenamine, 4, 4', 4'', 4'''- (1, 3, 6, 8- pyren etetrayltetra-2,1-ethynediyl)tetrakis-;1,3,6,8-tetrakis(4-aminophenyl)ethynylpyrene;4, 4', 4'', 4'''- (1, 3, 6, 8- pyren etetrayltetra-2,1-ethynediyl)tetrakis-Benzenamine;4,4 ', 4' ', 4' '- [Pyrene-1,3,6,8-tetrakis (ethyne-2,1-diyl)] tetraaniline;4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayltetrakis(ethyne-2,1-diyl))tetraaniline | | CAS: | 1404196-75-3 | | MF: | C48H30N4 | | MW: | 662.78 | | EINECS: | | | Product Categories: | | | Mol File: | 1404196-75-3.mol | ![[4,4',4'',4'''-[Pyrene-1,3,6,8-tetrayltetrakis(ethyne-2,1-diyl)]tetraaniline] Structure](CAS/20200401/GIF/1404196-75-3.gif) |
| | [4,4',4'',4'''-[Pyrene-1,3,6,8-tetrayltetrakis(ethyne-2,1-diyl)]tetraaniline] Chemical Properties |
| Boiling point | 998.5±65.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 4.36±0.30(Predicted) | | Appearance | Pink to red Solid | | InChIKey | XTBAGFFOEWDGGT-UHFFFAOYSA-N | | SMILES | C1(C#CC2=CC=C(N)C=C2)=C2C3=C4C(C=C2)=C(C#CC2=CC=C(N)C=C2)C=C(C#CC2=CC=C(N)C=C2)C4=CC=C3C(C#CC2=CC=C(N)C=C2)=C1 |
| | [4,4',4'',4'''-[Pyrene-1,3,6,8-tetrayltetrakis(ethyne-2,1-diyl)]tetraaniline] Usage And Synthesis |
| Uses | Used as a monomer for the synthesis of COF materials, such as TAEB-COF. |
| | [4,4',4'',4'''-[Pyrene-1,3,6,8-tetrayltetrakis(ethyne-2,1-diyl)]tetraaniline] Preparation Products And Raw materials |
|