|
|
| | ETHYL 3,5-DINITROBENZOATE Basic information |
| | ETHYL 3,5-DINITROBENZOATE Chemical Properties |
| Melting point | 94-95 °C (lit.) | | Boiling point | 382.88°C (rough estimate) | | density | 1.2950 | | refractive index | 1.5600 (estimate) | | storage temp. | Store at room temperature | | form | solid | | Appearance | White to off-white Solid | | BRN | 1995473 | | InChI | 1S/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 | | InChIKey | IBQREHJPMPCXQA-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O | | CAS DataBase Reference | 618-71-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39-24/25 | | WGK Germany | 3 | | HS Code | 29163990 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | ETHYL 3,5-DINITROBENZOATE Usage And Synthesis |
| Uses | Ethyl 3,5-dinitrobenzoate forms charge transfer spectra with n-alkane solutions containing hexakis(n-hexyloxy)triphenylene. Nuclear magnetic resonance spectra of ethyl 3,5-dinitrobenzoate was studied. | | Synthesis Reference(s) | Tetrahedron Letters, 37, p. 6375, 1996 DOI: 10.1016/0040-4039(96)01351-2 Journal of the American Chemical Society, 112, p. 9336, 1990 DOI: 10.1021/ja00181a040 Tetrahedron, 62, p. 1309, 2006 DOI: 10.1016/j.tet.2005.09.147 | | General Description | Ethyl 3,5-dinitrobenzoate forms charge transfer spectra with n-alkane solutions containing hexakis(n-hexyloxy)triphenylene. Nuclear magnetic resonance spectra of ethyl 3,5-dinitrobenzoate was studied. |
| | ETHYL 3,5-DINITROBENZOATE Preparation Products And Raw materials |
|