|
|
| | 2-Fluoro-5-nitrobenzonitrile Basic information |
| | 2-Fluoro-5-nitrobenzonitrile Chemical Properties |
| Melting point | 76-80 °C (lit.) | | Boiling point | 94 °C / 0.5mmHg | | density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Insoluble in water | | form | powder to crystal | | color | White to Yellow to Green | | BRN | 2048720 | | InChI | InChI=1S/C7H3FN2O2/c8-7-2-1-6(10(11)12)3-5(7)4-9/h1-3H | | InChIKey | YLACBMHBZVYOAP-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC([N+]([O-])=O)=CC=C1F | | CAS DataBase Reference | 17417-09-3(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36-36/37/39 | | RIDADR | 3439 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Fluoro-5-nitrobenzonitrile Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2-Fluoro-5-nitrobenzonitrile may be used in the preparation of:
- 2-fluoro-5-aminobenzonitrile
- ethyl 3-amino-5-nitro-benzo[b]thiophene-2-carboxylate
- 1-methyl-5-nitro-1H-indazol-3-ylamine
| | General Description | 2-Fluoro-5-nitrobenzonitrile can be prepared from 2-fluorobenzonitrile via nitration. |
| | 2-Fluoro-5-nitrobenzonitrile Preparation Products And Raw materials |
|