| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Ethyl 3,4-dihydroxycinnamate manufacturers
|
| | Ethyl 3,4-dihydroxycinnamate Basic information |
| Product Name: | Ethyl 3,4-dihydroxycinnamate | | Synonyms: | 2-Propenoicacid,3-(3,4-dihydroxyphenyl)-,ethylester,(2E)-(9CI);E-Caffeic acid ethyl ester;Zinc01614326;Ethyl-3,4-dihydroxycinnamte;2-Propenoic acid, 3-(3,4-dihydroxyphenyl)-, ethyl ester, (2E)-;ethyl (E)-caffeate;Ethyl 3,4-dihydroxycinnamate,97%;Ethyl transcaffeate,Ethyl trans caffeate | | CAS: | 66648-50-8 | | MF: | C11H12O4 | | MW: | 208.21 | | EINECS: | | | Product Categories: | ALCOHOL;Aromatic Esters | | Mol File: | 66648-50-8.mol |  |
| | Ethyl 3,4-dihydroxycinnamate Chemical Properties |
| Melting point | 147~151℃ | | Boiling point | 148-149 °C | | density | 1.271±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 8.71±0.18(Predicted) | | form | Off-white to brown solid. | | color | White to off-white | | biological source | plant | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C11H12O4/c1-2-15-11(14)6-4-8-3-5-9(12)10(13)7-8/h3-7,12-13H,2H2,1H3/b6-4+ | | InChIKey | WDKYDMULARNCIS-GQCTYLIASA-N | | SMILES | O(CC)C(=O)\C=C\c1cc(c(cc1)O)O | | LogP | 2.418 (est) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | Ethyl 3,4-dihydroxycinnamate Usage And Synthesis |
| Uses | Ethyl 3,4-dihydroxycinnamate shows anti-inflammatory, immunomodulatory, and anti-carcinogenic properties. It is a potent and specific inhibitor of NF-κB and its downstream inflammatory mediators: NOS2 (inducible nitric oxide synthase; NOS; NOS II), Cox-2 (cyclooxygenase-2), and prostaglandin E2 (PGE2). Ethyl 3,4-Dihydroxycinnamate prevents DNA single-strand breaks caused by H2O2. | | Definition | ChEBI: Ethyl trans-caffeate is an ethyl ester resulting from the formal condensation of the carboxy group of trans-caffeic acid with ethanol. It has a role as an anti-inflammatory agent and an antineoplastic agent. It is an alkyl caffeate ester and an ethyl ester. It is functionally related to a trans-caffeic acid. | | General Description | This substance is a primary reference substance with assigned absolute purity (considering chromatographic purity, water, residual solvents, inorganic impurities). The exact value can be found on the certificate. Produced by PhytoLab GmbH & Co. KG | | Biological Activity | Ethyl dihydroxycinnamate exhibits potent cytotoxicity, inhibits COX-2 and P-hydroxybenzoic acid, both involved in inflammation and cytokine synthesis. It demonstrates antibacterial efficacy against MRSA and Bacillus subtilis and inhibits cancer cell growth, countering tumor formation. |
| | Ethyl 3,4-dihydroxycinnamate Preparation Products And Raw materials |
|