|
|
| | 4-Bromofluorobenzene-d4 Basic information |
| Product Name: | 4-Bromofluorobenzene-d4 | | Synonyms: | 1-BROMO-4-FLUORO-BENZENE-RING-D4;1-Bromo-4-fluorobenzene-d4;p-Bromofluorobenzene-d4;1-bromo-4-fluoro-[2,3,5,6-2H4]benzene;[2H4]-p-Bromofluorobenzene;1-bromo-2,3,5,6-tetradeuterio-4-fluoro-benzene;Benzene-1,2,4,5-d4,3-bromo-6-fluoro;Tofacitinib Impurity 39 Monomer | | CAS: | 50592-31-9 | | MF: | C6BrD4F | | MW: | 179.02 | | EINECS: | | | Product Categories: | | | Mol File: | 50592-31-9.mol |  |
| | 4-Bromofluorobenzene-d4 Chemical Properties |
| Melting point | -16 °C(lit.) | | Boiling point | 150 °C(lit.) | | density | 1.629 g/mL at 25 °C | | Fp | 60 °C | | storage temp. | Refrigerator | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C6H4BrF/c7-5-1-3-6(8)4-2-5/h1-4H/i1D,2D,3D,4D | | InChIKey | AITNMTXHTIIIBB-RHQRLBAQSA-N | | SMILES | C1(F)C([2H])=C(C(Br)=C([2H])C=1[2H])[2H] |
| Hazard Codes | Xn | | Risk Statements | 20-36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Inhalation
Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
Skin Sens. 1 |
| | 4-Bromofluorobenzene-d4 Usage And Synthesis |
| Uses | p-Bromofluorobenzene-d4 is the isotope labelled analog of p-Bromofluorobenzene (B684545); a dihalogenated benzene used in the preparation of pharmaceutical compounds such as atypical antipsychotic agents. |
| | 4-Bromofluorobenzene-d4 Preparation Products And Raw materials |
|