|
|
| | Dicapryl Phthalate Basic information |
| Product Name: | Dicapryl Phthalate | | Synonyms: | bis(1-methylheptyl) phthalate;1,2-Benzenedicarboxylic acid, bis(1-methylheptyl) ester;Benzenedicarboxylic acid, bis(1-methylheptyl) ester;bis-(2-oktyl)ester kyseliny ftalove;Genomoll 100;Genomoll-100;Monoplex DCP;benzene-1,2-dicarboxylic acid bis(1-methylheptyl) ester | | CAS: | 131-15-7 | | MF: | C24H38O4 | | MW: | 390.55612 | | EINECS: | 2050142 | | Product Categories: | | | Mol File: | 131-15-7.mol |  |
| | Dicapryl Phthalate Chemical Properties |
| Boiling point | 435.74°C (rough estimate) | | density | 1.0101 (rough estimate) | | refractive index | 1.4460 (estimate) | | solubility | Chloroform (Soluble), Methanol (Sparingly) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C24H38O4/c1-5-7-9-11-15-19(3)27-23(25)21-17-13-14-18-22(21)24(26)28-20(4)16-12-10-8-6-2/h13-14,17-20H,5-12,15-16H2,1-4H3 | | InChIKey | RLRMXWDXPLINPJ-UHFFFAOYSA-N | | SMILES | C1(C(OC(C)CCCCCC)=O)=CC=CC=C1C(OC(C)CCCCCC)=O | | LogP | 8.516 (est) | | EPA Substance Registry System | Bis(1-methylheptyl) phthalate (131-15-7) |
| | Dicapryl Phthalate Usage And Synthesis |
| | Dicapryl Phthalate Preparation Products And Raw materials |
|