| Company Name: |
Shangfluoro Gold |
| Tel: |
021-65170832 15601903708 |
| Email: |
qinba_2@163.com |
Methyl perfluoro(2-methyl-3-oxahexanoate) manufacturers
|
| | Methyl perfluoro(2-methyl-3-oxahexanoate) Basic information |
| Product Name: | Methyl perfluoro(2-methyl-3-oxahexanoate) | | Synonyms: | HFPO DIMER ACID METHYL ESTER;METHYL UNDECAFLUORO-2-METHYL-3-OXAHEXANOATE;PERFLUORO(2-METHYL-3-OXAHEXANOIC ACID) METHYL ESTER;PERFLUORO(2-METHYL-3-OXAHEXANOIC ACID) METHYLESTER 97%;Methylperfluoro(2-methyl-3-oxahexanoate)97%;2-(Heptafluoropropoxy)-2,3,3,3-tetrafluoropropionic acid methyl ester;Methyl 2,3,3,3-tetrafluoro-2-(perfluoropropoxy)propanoate;Methyl 2-(heptafluoropropoxy)-2,3,3,3-tetrafluoropropanoate, Methyl 2-(heptafluoropropoxy)-2,3,3,3-tetrafluoropropionate, Methyl undecafluoro-2-methyl-3-oxahexanoate | | CAS: | 13140-34-6 | | MF: | C7H3F11O3 | | MW: | 344.08 | | EINECS: | | | Product Categories: | | | Mol File: | 13140-34-6.mol |  |
| | Methyl perfluoro(2-methyl-3-oxahexanoate) Chemical Properties |
| Boiling point | 115-117°C | | refractive index | 1.296 @ 25°C | | storage temp. | 2-8°C | | form | liquid | | color | Clear | | InChI | InChI=1S/C7H3F11O3/c1-20-2(19)3(8,5(11,12)13)21-7(17,18)4(9,10)6(14,15)16/h1H3 | | InChIKey | DSKGYKJXZRFRDP-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F | | EPA Substance Registry System | Methyl perfluoro(2-propoxypropanoate) (13140-34-6) |
| Hazard Codes | Xi | | Safety Statements | 23-24/25 | | HazardClass | IRRITANT | | HS Code | 2918999090 |
| | Methyl perfluoro(2-methyl-3-oxahexanoate) Usage And Synthesis |
| | Methyl perfluoro(2-methyl-3-oxahexanoate) Preparation Products And Raw materials |
|