|
|
| | (6-aminopyridin-2-yl)methanol Basic information |
| | (6-aminopyridin-2-yl)methanol Chemical Properties |
| Melting point | 70℃ | | Boiling point | 299℃ | | density | 1.257 | | Fp | 134℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Slightly soluble. | | pka | 13.40±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H8N2O/c7-6-3-1-2-5(4-9)8-6/h1-3,9H,4H2,(H2,7,8) | | InChIKey | YGMPMXTWKROXPP-UHFFFAOYSA-N | | SMILES | C1(CO)=NC(N)=CC=C1 |
| | (6-aminopyridin-2-yl)methanol Usage And Synthesis |
| Uses | 4-Aminopyridine (4-AP), a well-known potassium channel blocker, has been shown to enhance conduction in injured and demyelinated axons. Aminopyridine has a narrow therapeutic range in clinical application. In the current study, we investigated whether AP-MeOH can enhance impulse conduction in an animal model of MS. | | References | [1] Patent: WO2006/134467, 2006, A1. Location in patent: Page/Page column 34
[2] Patent: WO2006/106423, 2006, A2. Location in patent: Page/Page column 33-34 |
| | (6-aminopyridin-2-yl)methanol Preparation Products And Raw materials |
|