- TRIS(2-CYANOETHYL)PHOSPHINE
-
- $15.00 / 1KG
-
2021-07-13
- CAS:4023-53-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | TRIS(2-CYANOETHYL)PHOSPHINE Basic information |
| Product Name: | TRIS(2-CYANOETHYL)PHOSPHINE | | Synonyms: | TRIS(2-CYANOETHYL)PHOSPHINE;Tris(2-cyanoethyl)phosphine,min.99%;AURORA KA-1114;TRIS(2-CYANOETHYL)PHOSPHINE 92+%;Tris(2-cyanoethyl)phosphine,94%;Tris(2-cyanoethyl)phosphine, min. 99%;3,3',3''-Phosphinetriyltris(propiononitrile);3,3',3''-Phosphinidynetris(propiononitrile) | | CAS: | 4023-53-4 | | MF: | C9H12N3P | | MW: | 193.19 | | EINECS: | 223-687-0 | | Product Categories: | organophosphine ligand;Tertiary Phosphines | | Mol File: | 4023-53-4.mol |  |
| | TRIS(2-CYANOETHYL)PHOSPHINE Chemical Properties |
| Melting point | 97-98°C | | Boiling point | 235°C 0,9mm | | Fp | 235°C/0.9mm | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystal | | color | white | | Water Solubility | Soluble in DMSO, and DMF. Insoluble in water. | | Sensitive | Air & Moisture Sensitive | | Exposure limits | ACGIH: TWA 0.1 ppm; STEL 0.3 ppm
OSHA: TWA 0.75 ppm; STEL 2 ppm
NIOSH: IDLH 20 ppm; TWA 0.016 ppm; Ceiling 0.1 ppm | | InChI | InChI=1S/C9H12N3P/c10-4-1-7-13(8-2-5-11)9-3-6-12/h1-3,7-9H2 | | InChIKey | CHZAMJVESILJGH-UHFFFAOYSA-N | | SMILES | P(CCC#N)(CCC#N)CCC#N | | CAS DataBase Reference | 4023-53-4(CAS DataBase Reference) | | EPA Substance Registry System | Propanenitrile, 3,3',3''-phosphinidynetris- (4023-53-4) |
| Provider | Language |
|
ALFA
| English |
| | TRIS(2-CYANOETHYL)PHOSPHINE Usage And Synthesis |
| Uses | Tris(2-cyanoethyl)phosphine is used to produce 3,3',3''-phosphanetriyl-tri-propionic acid and hydrochloride by heating. It will need reagent conc. aq. HCl with reaction. |
| | TRIS(2-CYANOETHYL)PHOSPHINE Preparation Products And Raw materials |
|