|
|
| | 2,3,4,5,6-PENTAFLUOROBENZENEBORONIC ACID Basic information |
| | 2,3,4,5,6-PENTAFLUOROBENZENEBORONIC ACID Chemical Properties |
| Melting point | 176-179°C | | Boiling point | 244.0±50.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Miscible with alcohols, acetonitrile and dichloromethane. | | pka | 6.13±0.58(Predicted) | | form | powder | | color | White to Almost white | | Sensitive | Moisture Sensitive | | BRN | 3033960 | | InChI | InChI=1S/C6H2BF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H | | InChIKey | VASOMTXTRMYSKD-UHFFFAOYSA-N | | SMILES | B(C1=C(F)C(F)=C(F)C(F)=C1F)(O)O | | CAS DataBase Reference | 1582-24-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29319090 |
| Provider | Language |
|
ALFA
| English |
| | 2,3,4,5,6-PENTAFLUOROBENZENEBORONIC ACID Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Reactant for:
- Preparation of phenylboronic catechol esters as promising anion receptors for polymer electrolytes
- Preparation of biaryls via palladium-catalyzed homocoupling reaction
- Prepartion of quaternary a,a-heterodiaryl carboxylic esters via rhodium-catalyzed cross-coupling
- C-C cross-coupling reactions
| | Uses | 2,3,4,5,6-Pentafluorobenzeneboronic acid is utilized in the palladium-catalyzed Suzuki reaction to synthesize several cross-coupled aromatic compounds, for example bis(pentafluorophenyl)-substituted thiophene and selenophene derivatives. It serves as an intermediate and raw material in pharmaceutical and chemical industry. It is also used in dyes and pigments. It can be used to prepare cyclic boronates of bifunctional compounds. |
| | 2,3,4,5,6-PENTAFLUOROBENZENEBORONIC ACID Preparation Products And Raw materials |
|