6-Cyano-1-indanone manufacturers
- 6-Cyano-1-indanone
-
- $6.68 / 1KG
-
2020-01-10
- CAS:69975-66-2
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| | 6-Cyano-1-indanone Basic information |
| | 6-Cyano-1-indanone Chemical Properties |
| Melting point | 109 °C | | Boiling point | 312.6±31.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | color | Pale yellow | | InChI | InChI=1S/C10H7NO/c11-6-7-1-2-8-3-4-10(12)9(8)5-7/h1-2,5H,3-4H2 | | InChIKey | UJBIKXKXAWDYIB-UHFFFAOYSA-N | | SMILES | C1C2=C(C=C(C#N)C=C2)C(=O)C1 |
| | 6-Cyano-1-indanone Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 58, p. 5386, 1993 DOI: 10.1021/jo00072a020 |
| | 6-Cyano-1-indanone Preparation Products And Raw materials |
|