| Company Name: |
Shanghai Haohong Pharmaceutical Co., Ltd. Gold
|
| Tel: |
400-8210725 4008210725 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Product Name:5-Bromo-2,3-dihydro-1H-inden-4-ol
CAS:575504-23-3
Purity:96% Package:1g
|
| Company Name: |
Shanghai Merlot Chemical Co., LTD Gold
|
| Tel: |
15821661757 |
| Email: |
226174156@qq.com |
| Products Intro: |
Product Name:5-broMoindan-4-ol
CAS:575504-23-3
Purity:95% HPLC Package:1 g，5 g，10 g
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-164-7117 13681763483 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:5-Bromo-2,3-dihydro-1H-inden-4-ol
CAS:575504-23-3
Purity:97% Package:100mg;250mg;1g;5g Remarks:BD01390215
|
|
| | 5-broMoindan-4-ol Basic information |
| Product Name: | 5-broMoindan-4-ol | | Synonyms: | 5-broMoindan-4-ol;5-bromo-2,3-dihydro-1H-Inden-4-ol;1H-Inden-4-ol, 5-bromo-2,3-dihydro-;5-Bromo-4-indanol | | CAS: | 575504-23-3 | | MF: | C9H9BrO | | MW: | 213.07 | | EINECS: | | | Product Categories: | | | Mol File: | 575504-23-3.mol |  |
| | 5-broMoindan-4-ol Chemical Properties |
| Boiling point | 258.4±40.0 °C(Predicted) | | density | 1.600±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 8.84±0.20(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C9H9BrO/c10-8-5-4-6-2-1-3-7(6)9(8)11/h4-5,11H,1-3H2 | | InChIKey | GOMUHOXBRCTZLM-UHFFFAOYSA-N | | SMILES | C1C2=C(C(O)=C(Br)C=C2)CC1 |
| | 5-broMoindan-4-ol Usage And Synthesis |
| | 5-broMoindan-4-ol Preparation Products And Raw materials |
|