|
|
| | AZD 7762 hydrochloride Basic information |
| Product Name: | AZD 7762 hydrochloride | | Synonyms: | 5-(3-Fluorophenyl)-3-ureidothiophene-2-carboxylic acid N-[(S)-piperidin-3-yl]amide hydrochloride;AZD 7762 hydrochloride;AZD-7762 hydrochloride;AZD7762 HCl;AZD-7762 hydrochloride >=98% (HPLC);3-[(Aminocarbonyl)amino]-5-(3-fluorophenyl)-N-(3S)-3-piperidinyl-2-thiophenecarboxamide hydrochloride;AZD-7762 hydrochloride ≥95%;AZD7762 HCl,AZD-7762 HCl | | CAS: | 1246094-78-9 | | MF: | C17H20ClFN4O2S | | MW: | 398.88 | | EINECS: | | | Product Categories: | | | Mol File: | 1246094-78-9.mol |  |
| | AZD 7762 hydrochloride Chemical Properties |
| storage temp. | -20°C | | solubility | DMSO: soluble15mg/mL, clear | | form | powder | | color | white to light brown | | InChIKey | WFZBLOIXZRZEDG-YDALLXLXSA-N | | SMILES | Cl.NC(=O)Nc1cc(sc1C(=O)N[C@H]2CCCNC2)-c3cccc(F)c3 |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | AZD 7762 hydrochloride Usage And Synthesis |
| Uses | AZD 7762 Hydrochloride is a checkpoint kinase inhibitor (CHK1 and CHK2); these checkpoints are responsible for responding to DNA damage that results in cell cycle arrest. | | Biological Activity | AZD-7762 is a potent, ATP-competitive inhibitor of Chk1 and Chk2 th at enhanced cytotoxicity DNA-damaging agents. | | storage | Store at -20°C |
| | AZD 7762 hydrochloride Preparation Products And Raw materials |
|