Angiontensin(1-7) manufacturers
- Zoliflodacin
-
- $100.00
-
2026-09-21
- CAS:1620458-09-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000 KG
|
| | Angiontensin(1-7) Basic information |
| Product Name: | Angiontensin(1-7) | | Synonyms: | Angiontensin(1-7);AZD0914;(2R,4S,4aS)-11-Fluoro-1,2,4,4a-tetrahydro-2,4-dimethyl-8-[(4S)-4-methyl-2-oxo-3-oxazolidinyl]spiro[isoxazolo[4,5-g][1,4]oxazino[4,3-a]quinoline-5(6H),5'(2'H)-pyrimidine]-2',4',6'(1'H,3'H)-trione;ETX0914;AZD0914;Zoliflodacin(AZD0914);CAS#1620458-09-4.;ETX 0914;ETX-0914 | | CAS: | 1620458-09-4 | | MF: | C22H22FN5O7 | | MW: | 487.44 | | EINECS: | | | Product Categories: | | | Mol File: | 1620458-09-4.mol |  |
| | Angiontensin(1-7) Chemical Properties |
| density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 25 mg/ml; Ethanol: 25 mg/ml | | form | A solid | | pka | 10.44±0.60(Predicted) | | color | White to off-white | | InChIKey | ZSWMIFNWDQEXDT-ZESJGQACSA-N | | SMILES | N12C[C@@H](C)O[C@@H](C)[C@]1([H])C1(C(=O)NC(=O)NC1=O)CC1C2=C(F)C2ON=C(N3[C@@H](C)COC3=O)C=2C=1 |
| | Angiontensin(1-7) Usage And Synthesis |
| Uses | Zoliflodacin, is a spiropyrimidinetrione bacterial DNA gyrase/topoisomerase inhibitor, and has in vitro antibacterial activity against Gram-positive and Gram-negative organisms, including S. aureus. | | IC 50 | Quinolone |
| | Angiontensin(1-7) Preparation Products And Raw materials |
|