|
|
| | 3,5-bis(sulfanyl)benzoic Acid Basic information |
| | 3,5-bis(sulfanyl)benzoic Acid Chemical Properties |
| Melting point | 204-205 °C(Solv: hexane (110-54-3); ethyl ether (60-29-7)) | | Boiling point | 396.7±32.0 °C(Predicted) | | density | 1.464±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 3.70±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C7H6O2S2/c8-7(9)4-1-5(10)3-6(11)2-4/h1-3,10-11H,(H,8,9) | | InChIKey | SZYZOUJPUFNQKS-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(S)=CC(S)=C1 |
| | 3,5-bis(sulfanyl)benzoic Acid Usage And Synthesis |
| Uses | 3,5-Bis(sulfanyl)benzoic acid is an aromatic compound with sulfur and ester bonds, and its derivatives are used in the preparation of semiconductor devices. |
| | 3,5-bis(sulfanyl)benzoic Acid Preparation Products And Raw materials |
|