| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:2-(2-Cyanophenylthio)benzoic acid CAS:163725-12-0 Purity:97% Package:100G,500G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2-(2-Cyanophenylthio)benzoic acid CAS:163725-12-0 Purity:97% Package:500G Remarks:346306-500G
|
| Company Name: |
Nanjing Shizhou Biology Technology Co.,Ltd
|
| Tel: |
025-85563444 15850508050 |
| Email: |
purchase@synzest.com |
| Products Intro: |
Product Name:2-(2-CYANOPHENYLTHIO)BENZOIC ACID CAS:163725-12-0 Purity:95% Package:1g;5g;10g
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:2-(2-Cyanophenylthio)benzoic acid CAS:163725-12-0
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:2-(2-Cyanophenylthio)benzoic acid CAS:163725-12-0
|
|
| | 2-(2-CYANOPHENYLTHIO)BENZOIC ACID Basic information |
| | 2-(2-CYANOPHENYLTHIO)BENZOIC ACID Chemical Properties |
| Melting point | 210-215 °C (lit.) | | Boiling point | 423.7±30.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | pka | 3.34±0.36(Predicted) | | InChI | 1S/C14H9NO2S/c15-9-10-5-1-3-7-12(10)18-13-8-4-2-6-11(13)14(16)17/h1-8H,(H,16,17) | | InChIKey | FMGHXZOIAXNGOL-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccccc1Sc2ccccc2C#N |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-(2-CYANOPHENYLTHIO)BENZOIC ACID Usage And Synthesis |
| | 2-(2-CYANOPHENYLTHIO)BENZOIC ACID Preparation Products And Raw materials |
|