| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
(+)-ISOPINOCAMPHEOL manufacturers
|
| | (+)-ISOPINOCAMPHEOL Basic information |
| Product Name: | (+)-ISOPINOCAMPHEOL | | Synonyms: | ISOPINOCAMPHEOL, (+)-;(1s,2s,3s,5r)-2,6,6-trimethylbicyclo[3.1.1]heptan-3-ol;ISOPINOCAMPHEOL, (-)-(SG);(1S,2S,3S,5R)-3-Pinanol, 3-Pinanol, (1S,2S,3S,5R)-2,6,6-Trimethylbicyclo[3.1.1]heptan-3-ol;(1S,2S,3S,5R)-3-Pinanol, (1S,2S,3S,5R)-2,6,6-Trimethylbicyclo[3.1.1]heptan-3-ol;Bicyclo[3.1.1]heptan-3-ol, 2,6,6-trimethyl-, (1.alpha.,2.beta.,3.alpha.,5.alpha.)-;Nsc167499;(1S,2S,3S,5R)-(+)-IsopinocaMpheol 98% | | CAS: | 27779-29-9 | | MF: | C10H18O | | MW: | 154.25 | | EINECS: | 248-657-4 | | Product Categories: | | | Mol File: | 27779-29-9.mol |  |
| | (+)-ISOPINOCAMPHEOL Chemical Properties |
| Melting point | 52-55 °C | | Boiling point | 219 °C(lit.) | | density | 0.8389 (rough estimate) | | refractive index | 1.4710 (estimate) | | Fp | 93 °C | | pka | 15.35±0.60(Predicted) | | form | solid | | Optical Rotation | [α]20/D +35.1°, c =20 in ethanol | | InChI | 1S/C10H18O/c1-6-8-4-7(5-9(6)11)10(8,2)3/h6-9,11H,4-5H2,1-3H3/t6-,7+,8-,9-/m0/s1 | | InChIKey | REPVLJRCJUVQFA-KZVJFYERSA-N | | SMILES | C[C@@H]1[C@@H](O)CC2CC1C2(C)C | | LogP | 2.805 (est) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (+)-ISOPINOCAMPHEOL Usage And Synthesis |
| Uses | (1S,2S,3S,5R)-(+)-Isopinocampheol may be used in the preparation of
- thermotropic chiral nematic side-chain copolymers
- ortho-(diphenylphosphino)phenylphosphonous acid di[(1S,2S,3S,5R)-2,6,6-trimethyl-bicyclo[3.1.1]-hept-3-yl]ester, a phosphino-phosphonite ligand
- O,O′bis[(1S,2S,3S,5R)2,6,6-trimethylbicyclo[3.1.1]hept-3-yl] dithiophosphoric acid, a bioactive compound with antifungal effect
| | General Description | (1S,2S,3S,5R)-(+)-Isopinocampheol is a chiral terpenol. | | Purification Methods | Dissolve it in Et2O, dry over MgSO4, filter, evaporate, then recrystallise it from pet ether. Also recrystallise it from aqueous EtOH and distil it in a vacuum. [Kergomard & Geneix Bull Soc Chim Fr 394 1958, Zweifel & Brown J Am Chem Soc 86 393 1964.] The 3,4-dinitrobenzoyl derivative has m 100-101o, the phenylcarbamoyl derivative has m 137-138o and the acid -phthalate has m 125-126o. [Beilstein 6 III 282, 283.] |
| | (+)-ISOPINOCAMPHEOL Preparation Products And Raw materials |
|