2-FLUORO-5-FORMYLBENZOIC ACID 95 manufacturers
|
| | 2-FLUORO-5-FORMYLBENZOIC ACID 95 Basic information |
| Product Name: | 2-FLUORO-5-FORMYLBENZOIC ACID 95 | | Synonyms: | 2-FLUORO-5-FORMYLBENZOIC ACID 95;2-Fluoro-5-formylbenzoic acid 95%;3-Carboxy-4-fluorobenzaldehyde;5-(1,3-dioxolan-2-yl)-2-fluorobenzoic acid;Olaparib Imp.33;Benzoic acid, 2-fluoro-5-formyl-;2-FLUORO-5-FORMYLBENZOIC ACID 95 ISO 9001：2015 REACH | | CAS: | 550363-85-4 | | MF: | C8H5FO3 | | MW: | 168.12 | | EINECS: | | | Product Categories: | john's | | Mol File: | 550363-85-4.mol |  |
| | 2-FLUORO-5-FORMYLBENZOIC ACID 95 Chemical Properties |
| Melting point | 174.5-178.5 | | Boiling point | 330.9±27.0 °C(Predicted) | | density | 1.426±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 2.92±0.10(Predicted) | | InChI | InChI=1S/C8H5FO3/c9-7-2-1-5(4-10)3-6(7)8(11)12/h1-4H,(H,11,12) | | InChIKey | XZUFXXPSLGVLFC-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(C=O)=CC=C1F |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HS Code | 2918300090 |
| | 2-FLUORO-5-FORMYLBENZOIC ACID 95 Usage And Synthesis |
| | 2-FLUORO-5-FORMYLBENZOIC ACID 95 Preparation Products And Raw materials |
|