|
|
| | 5-(2,5-Dichlorophenyl)furfural Basic information |
| | 5-(2,5-Dichlorophenyl)furfural Chemical Properties |
| Melting point | 97-101 °C(lit.) | | form | powder | | color | Yellow | | InChI | 1S/C11H6Cl2O2/c12-7-1-3-10(13)9(5-7)11-4-2-8(6-14)15-11/h1-6H | | InChIKey | RKZWOCAAXGBQBN-UHFFFAOYSA-N | | SMILES | Clc1ccc(Cl)c(c1)-c2ccc(C=O)o2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2932190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-(2,5-Dichlorophenyl)furfural Usage And Synthesis |
| | 5-(2,5-Dichlorophenyl)furfural Preparation Products And Raw materials |
|