| Company Name: |
Shanghai UCHEM Inc. Gold
|
| Tel: |
18939844854 |
| Email: |
sales6@myuchem.com |
| Products Intro: |
Product Name:4,4'-(1,10-Phenanthroline-2,9-diyl)diphenol
CAS:88498-43-5
Purity:97.0% Package:5g;10g;25g;50g
|
| Company Name: |
Beijing HwrkChemical Technology Co., Ltd
|
| Tel: |
18515581800 18501085097 |
| Email: |
sales.bj@hwrkchemical.com |
| Products Intro: |
Product Name:4,4'-(1,10-Phenanthroline-2,9-diyl)diphenol
CAS:88498-43-5
Purity:98.00% Package:1g
|
4,4'-(1,10-Phenanthroline-2,9-diyl)diphenol manufacturers
|
| | 4,4'-(1,10-Phenanthroline-2,9-diyl)diphenol Basic information |
| Product Name: | 4,4'-(1,10-Phenanthroline-2,9-diyl)diphenol | | Synonyms: | 4,4'-(1,10-Phenanthroline-2,9-diyl)diphenol;Phenol, 4,4'-(1,10-phenanthroline-2,9-diyl)bis-;2,9-Bis(4-hydroxyphenyl)-1,10-phenanthroline | | CAS: | 88498-43-5 | | MF: | C24H16N2O2 | | MW: | 364.4 | | EINECS: | | | Product Categories: | | | Mol File: | 88498-43-5.mol |  |
| | 4,4'-(1,10-Phenanthroline-2,9-diyl)diphenol Chemical Properties |
| Melting point | >260 °C | | Boiling point | 632.9±50.0 °C(Predicted) | | density | 1.341±0.06 g/cm3(Predicted) | | pka | 8.32±0.15(Predicted) | | InChI | InChI=1S/C24H16N2O2/c27-19-9-3-15(4-10-19)21-13-7-17-1-2-18-8-14-22(26-24(18)23(17)25-21)16-5-11-20(28)12-6-16/h1-14,27-28H | | InChIKey | GTOXEYAZDAJKFU-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=C(C2=CC=C(O)C=C2)C=C3)C=CC=1C1=CC=C(O)C=C1 |
| | 4,4'-(1,10-Phenanthroline-2,9-diyl)diphenol Usage And Synthesis |
| | 4,4'-(1,10-Phenanthroline-2,9-diyl)diphenol Preparation Products And Raw materials |
|