1-Benzylazetidin-3-one manufacturers
- 1-BENZYLAZETIDIN-3-ONE
-
- $1.00
-
2020-01-13
- CAS:156303-83-2
- Min. Order: 1KG
- Purity: 98%-99.9%
- Supply Ability: 100kg
|
| | 1-Benzylazetidin-3-one Basic information |
| Product Name: | 1-Benzylazetidin-3-one | | Synonyms: | 1-(Phenylmethyl)-3-azetidinone;1-Benzyl-3-oxoazetidine;1-Benzyl-3-azetidinone;N-Benzyl-3-azetidinone;3-Azetidinone,1-(phenylMethyl)-;1-Benzylazetidin-3-one | | CAS: | 156303-83-2 | | MF: | C10H11NO | | MW: | 161.2 | | EINECS: | | | Product Categories: | | | Mol File: | 156303-83-2.mol |  |
| | 1-Benzylazetidin-3-one Chemical Properties |
| Boiling point | 257℃ | | density | 1.178 | | Fp | 102℃ | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 4.05±0.20(Predicted) | | InChI | InChI=1S/C10H11NO/c12-10-7-11(8-10)6-9-4-2-1-3-5-9/h1-5H,6-8H2 | | InChIKey | BNTLMZDFEGZLOR-UHFFFAOYSA-N | | SMILES | N1(CC2=CC=CC=C2)CC(=O)C1 |
| | 1-Benzylazetidin-3-one Usage And Synthesis |
| | 1-Benzylazetidin-3-one Preparation Products And Raw materials |
|