- 2-HYDROXYANTHRAQUINONE
-
- $25.00 / 1ASSAYS
-
2026-03-20
- CAS:605-32-3
- Min. Order: 100ASSAYS
- Purity: 99.5%
- Supply Ability: 100 mt
|
| | 2-HYDROXYANTHRAQUINONE Basic information |
| Product Name: | 2-HYDROXYANTHRAQUINONE | | Synonyms: | 2-hydroxyanthracene-9,10-dione;3-Hydroxy-9,10-anthraquinone;NSC 2595;9,10-Anthracenedione,2-hydroxy-;10-Anthracenedione,2-hydroxy-9;2-hydroxy-10-anthracenedione;2-hydroxy-9,10-anthracenedione;2-Hydroxy-9,10-anthraquinone | | CAS: | 605-32-3 | | MF: | C14H8O3 | | MW: | 224.21 | | EINECS: | 210-085-8 | | Product Categories: | Anthraquinones;Hydroxyanthraquinones | | Mol File: | 605-32-3.mol |  |
| | 2-HYDROXYANTHRAQUINONE Chemical Properties |
| Melting point | 314℃ (acetic acid ) | | Boiling point | 325.61°C (rough estimate) | | density | 1.2337 (rough estimate) | | refractive index | 1.5400 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMF: 5 mg/ml,DMSO: 30 mg/ml | | form | A solid | | pka | 7.41±0.20(Predicted) | | color | Yellow to green yellow | | Henry's Law Constant | 5.4×105 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) | | InChI | 1S/C14H8O3/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7,15H | | InChIKey | GCDBEYOJCZLKMC-UHFFFAOYSA-N | | SMILES | Oc1ccc2C(=O)c3ccccc3C(=O)c2c1 | | EPA Substance Registry System | 9,10-Anthracenedione, 2-hydroxy- (605-32-3) |
| Hazard Codes | N | | Risk Statements | 36/37/38-51/53 | | Safety Statements | 26-36/37/39-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | WGK 3 | | RTECS | CB7250000 | | TSCA | TSCA listed | | HazardClass | 9 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 |
| | 2-HYDROXYANTHRAQUINONE Usage And Synthesis |
| Uses | 2-Hydroxyanthraquinone, a natural compound, possesses antitumor and immunosuppressive activity[1]. | | Definition | ChEBI: 2-hydroxyanthraquinone is a monohydroxyanthraquinone. | | References | [1] I Hilgert, et al. Antitumour and immunosuppressive activity of hydroxyanthraquinones and their glucosides. Folia Biol (Praha). 1977;23(2):99-109. PMID:863051 |
| | 2-HYDROXYANTHRAQUINONE Preparation Products And Raw materials |
| Raw materials | 2-hydroxy-10H-anthracen-9-one-->2-carbomethoxy-9,10-anthraquinone-->hystazarin-->9,10-Anthracenedione, 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)--->2,3-BIS(TRIMETHYLSILYLOXY)-1,3-BUTADIENE-->Bianthrone-->1-Hydroxy anthraquinone-->Phenol-->3-Hydroxybenzaldehyde-->1,4-Dihydroxyanthraquinone-->Anthraquinone-->Sodium anthraquinone-2-sulfonate-->1,4-Naphthoquinone-->2-AMINOANTHRAQUINONE | | Preparation Products | 2-HYDROXYANTHRACENE
-->1,4-Dihydroxyanthraquinone |
|