| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 18918157536; |
| Email: |
sales8178@energy-chemical.com |
|
| | R(-)-8a-methyl-3,4,8,8a-tetrahydro-1,6(2H,7H)-naphthalenedione Basic information |
| Product Name: | R(-)-8a-methyl-3,4,8,8a-tetrahydro-1,6(2H,7H)-naphthalenedione | | Synonyms: | WIELAND-MIESCHER KETONE, R-(-)-ISOMER;(R)-MIESCHER-WIELAND KETONE;R(-)-9-METHYL-5(10)-OCTALINE-1,6-DIONE;(R)-(-)-3,4,8,8A-TETRAHYDRO-8A-METHYL-1,6(2H,7H)-NAPHTHALENEDIONE;(R)-(-)-9-Methyl-delta-(5,10)-octalin-1,6-dione;(R)-Wieland-Miescherketone;R(-)-8a-Methyl-3,4,8,8a-tetrahydro-1,6(2H,7H)-naphthalenendione;(r)-(-)-9-methyl-e( | | CAS: | 100348-93-4 | | MF: | C11H14O2 | | MW: | 178.23 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 100348-93-4.mol |  |
| | R(-)-8a-methyl-3,4,8,8a-tetrahydro-1,6(2H,7H)-naphthalenedione Chemical Properties |
| Melting point | 49-51 °C | | storage temp. | 2-8°C | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D 98±2°, c = 1.1% in benzene | | BRN | 2050425 | | InChI | InChI=1S/C11H14O2/c1-11-6-5-9(12)7-8(11)3-2-4-10(11)13/h7H,2-6H2,1H3/t11-/m1/s1 | | InChIKey | DNHDRUMZDHWHKG-LLVKDONJSA-N | | SMILES | C1(=O)[C@@]2(C)C(=CC(=O)CC2)CCC1 |
| | R(-)-8a-methyl-3,4,8,8a-tetrahydro-1,6(2H,7H)-naphthalenedione Usage And Synthesis |
| | R(-)-8a-methyl-3,4,8,8a-tetrahydro-1,6(2H,7H)-naphthalenedione Preparation Products And Raw materials |
|