|
|
| | 1,3-Dibromo-2-chloro-5-fluorobenzene Basic information |
| Product Name: | 1,3-Dibromo-2-chloro-5-fluorobenzene | | Synonyms: | 1-Chloro-2,6-dibromo-4-fluorobenzene, 99.5+%;1-Chloro-2,6-dibromo-4-fluorobenzene 98%;1-Chloro-2,6-dibromo-4-fluorobenzene98%;2-CHLORO-1,3-DIBROMO-5-FLUOROBENZENE 98%;4-CHLORO-3,5-DIBROMO-1-FLUOROBENZENE;2-CHLORO-1,3-DIBROMO-5-FLUOROBENZENE;1-CHLORO-2,6-DIBROMO-4-FLUOROBENZENE;2,6-Dibromo-4-fluorochlorobenzene | | CAS: | 179897-90-6 | | MF: | C6H2Br2ClF | | MW: | 288.34 | | EINECS: | 605-874-2 | | Product Categories: | API intermediates;Bromine Compounds;Chlorine Compounds;Fluorine Compounds | | Mol File: | 179897-90-6.mol |  |
| | 1,3-Dibromo-2-chloro-5-fluorobenzene Chemical Properties |
| Melting point | 85-87 °C | | Boiling point | 260℃ | | density | 2.089 | | refractive index | 1.6020 (estimate) | | Fp | 111℃ | | storage temp. | Sealed in dry,Room Temperature | | form | crystalline solid | | color | Off white to faint yellow | | InChI | InChI=1S/C6H2Br2ClF/c7-4-1-3(10)2-5(8)6(4)9/h1-2H | | InChIKey | PZKDJJMHRYNBOR-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(F)=CC(Br)=C1Cl | | CAS DataBase Reference | 179897-90-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | Hazard Note | Irritant | | HS Code | 2903998090 |
| | 1,3-Dibromo-2-chloro-5-fluorobenzene Usage And Synthesis |
| Chemical Properties | pink to pink-brown needles | | Uses | 1,3-Dibromo-2-chloro-5-fluorobenzene is an important organic reagent that can be used as a building block for the synthesis of many organic compounds, such as 3-bromo-5-fluoro-11-methyl-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene and 6-(3'-bromo-2,2'-dichloro-5'-fluoro-[l,r-biphenyl]-3-yl)-2-methoxynicotinaldehyde. |
| | 1,3-Dibromo-2-chloro-5-fluorobenzene Preparation Products And Raw materials |
|