| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-58581007 18019463053 |
| Email: |
sales@coolpharm.com |
methyl 1-methyl-5-(4-methylbenzoyl)-1H-pyrrole-2-acetate manufacturers
|
| | methyl 1-methyl-5-(4-methylbenzoyl)-1H-pyrrole-2-acetate Basic information |
| Product Name: | methyl 1-methyl-5-(4-methylbenzoyl)-1H-pyrrole-2-acetate | | Synonyms: | methyl 1-methyl-5-(4-methylbenzoyl)-1H-pyrrole-2-acetate;METHYL 1-METHYL-5-(P-TOLUOYL)-2-PYRROLYLACETAT;1-Methyl-5-(4-methylbenzoyl)-1H-pyrrole-2-acetic acid methyl ester;SIXINSDWVSIFEY-UHFFFAOYSA-N;1H-Pyrrole-2-acetic acid, 1-methyl-5-(4-methylbenzoyl)-, methyl ester;Tormetin methyl ester;methyl2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate; methyl 1-methyl-5-(4-methylbenzoyl) | | CAS: | 33369-52-7 | | MF: | C16H17NO3 | | MW: | 271.31 | | EINECS: | 251-480-5 | | Product Categories: | | | Mol File: | 33369-52-7.mol |  |
| | methyl 1-methyl-5-(4-methylbenzoyl)-1H-pyrrole-2-acetate Chemical Properties |
| Boiling point | 427.6±40.0 °C(Predicted) | | density | 1.11 | | pka | -8.00±0.70(Predicted) | | InChI | InChI=1S/C16H17NO3/c1-11-4-6-12(7-5-11)16(19)14-9-8-13(17(14)2)10-15(18)20-3/h4-9H,10H2,1-3H3 | | InChIKey | SIXINSDWVSIFEY-UHFFFAOYSA-N | | SMILES | N1(C)C(C(=O)C2=CC=C(C)C=C2)=CC=C1CC(OC)=O |
| | methyl 1-methyl-5-(4-methylbenzoyl)-1H-pyrrole-2-acetate Usage And Synthesis |
| | methyl 1-methyl-5-(4-methylbenzoyl)-1H-pyrrole-2-acetate Preparation Products And Raw materials |
|