| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 18918157536; |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
(-)-Isopinocampheylamine manufacturers
|
| | (-)-Isopinocampheylamine Basic information |
| Product Name: | (-)-Isopinocampheylamine | | Synonyms: | (1R,2R,3R,5S)-3-PINANAMINE;(1R,2R,3R,5S)-(-)-ISOPINOCAMPHEYLAMINE,95%;(-)-Isopinocampheylamine, (1R,2R,3R,5S)-3-Pinanamine;(1R,2R,3R,5S)-2,6,6-;(1R,2R,3R,5S)-(-)-Isopinocampheylamine 95%;(1R,2R,3R,5S)-2,6,6-Trimethyl-bicyclo[3.1.1]heptan-3-amine;Bicyclo[3.1.1]heptan-3-amine, 2,6,6-trimethyl-, (1R,2R,3R,5S)-;(1R,2R,3R,5S)-(?)-Isopinocampheylamine | | CAS: | 69460-11-3 | | MF: | C10H19N | | MW: | 153.26 | | EINECS: | | | Product Categories: | | | Mol File: | 69460-11-3.mol |  |
| | (-)-Isopinocampheylamine Chemical Properties |
| Melting point | 250 °C | | Boiling point | 90 °C18 mm Hg(lit.) | | density | 0.914 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.48(lit.) | | Fp | 162 °F | | storage temp. | 2-8°C, protect from light | | pka | 11.03±0.60(Predicted) | | form | Liquid | | color | Colorless to yellow | | Optical Rotation | [α]21/D 42°, neat | | InChI | 1S/C10H19N/c1-6-8-4-7(5-9(6)11)10(8,2)3/h6-9H,4-5,11H2,1-3H3/t6-,7+,8-,9-/m1/s1 | | InChIKey | VPTSZLVPZCTAHZ-BZNPZCIMSA-N | | SMILES | C[C@H]1[C@H](N)CC2CC1C2(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (-)-Isopinocampheylamine Usage And Synthesis |
| Uses | (1R,2R,3R,5S)-(-)-Isopinocampheylamine can be used to treat conditions associated with STING activity. |
| | (-)-Isopinocampheylamine Preparation Products And Raw materials |
|