|
|
| | 1-(tert-Butoxycarbonyl)-3,3-dimethyl-4-oxopiperidine Basic information |
| Product Name: | 1-(tert-Butoxycarbonyl)-3,3-dimethyl-4-oxopiperidine | | Synonyms: | 1-(TERT-BUTOXYCARBONYL)-3,3-DIMETHYL-4-OXOPIPERIDINE;tert-butyl 3,3-dimethyl-4-oxopiperidine-1-carboxylate;1-Piperidinecarboxylic acid, 3,3-diMethyl-4-oxo-, 1,1-diMethylethyl ester;1,1-Dimethylethyl 3,3-dimethyl-4-oxo-1-piperidinecarboxylate;1-tert-Butoxycarbonyl-3,3-dimethyl-4-piperidone;1-tert-Butyloxycarbonyl-3,3-dimethyl-4-piperidone;3,3-Dimethyl-4-oxo-1-piperidinecarboxylic acid tert-butyl ester;tert-butyl 3,3-diMethyl-4-oxopiperidine-1-carb | | CAS: | 324769-06-4 | | MF: | C12H21NO3 | | MW: | 227.3 | | EINECS: | | | Product Categories: | | | Mol File: | 324769-06-4.mol |  |
| | 1-(tert-Butoxycarbonyl)-3,3-dimethyl-4-oxopiperidine Chemical Properties |
| Boiling point | 303℃ | | density | 1.035 | | Fp | 137℃ | | storage temp. | 2-8°C | | pka | -1.51±0.40(Predicted) | | form | solid | | color | off white | | InChI | InChI=1S/C12H21NO3/c1-11(2,3)16-10(15)13-7-6-9(14)12(4,5)8-13/h6-8H2,1-5H3 | | InChIKey | MXCAGVCUIHYAGH-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(=O)C(C)(C)C1 |
| HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 1-(tert-Butoxycarbonyl)-3,3-dimethyl-4-oxopiperidine Usage And Synthesis |
| | 1-(tert-Butoxycarbonyl)-3,3-dimethyl-4-oxopiperidine Preparation Products And Raw materials |
|