|
|
| | 5-Chloro-2-methylene-1,3,3-trimethylindoline Basic information |
| Product Name: | 5-Chloro-2-methylene-1,3,3-trimethylindoline | | Synonyms: | 5-CHLORO-1,3,3-TRIMETHYL-2-METHYLENEINDOLINE;5-CHLORO-2-METHYLENE-1,3,3-TRIMETHYL-IND OLINE, TECH., 95%;1H-Indole, 5-chloro-2,3-dihydro-1,3,3-trimethyl-2-methylene-;5-chloro-2,3-dihydro-1,3,3-trimethyl-2-methylene-1h-indol;1,3,3-Trimethyl-2-methylene-2,3-dihydro-5-chloro-1H-indole;1,3,3-Trimethyl-2-methylene-5-chloro-2,3-dihydro-1H-indole;1,3,3-Trimethyl-2-methylene-5-chloroindoline;5-chloro-1,3,3-trimethyl-2-methylideneindole | | CAS: | 6872-17-9 | | MF: | C12H14ClN | | MW: | 207.7 | | EINECS: | 229-972-6 | | Product Categories: | Heterocycle-Indole series;Pyridines ,Halogenated Heterocycles;IndolinesBuilding Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks;Indolines;Intermediates of Dyes and Pigments;Organics;Indoline & Oxindole | | Mol File: | 6872-17-9.mol |  |
| | 5-Chloro-2-methylene-1,3,3-trimethylindoline Chemical Properties |
| Boiling point | 139 °C / 11mmHg | | density | 1.083 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.594(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | pka | 1.12±0.40(Predicted) | | Specific Gravity | 1.083 | | color | Orange to Brown to Dark purple | | InChI | 1S/C12H14ClN/c1-8-12(2,3)10-7-9(13)5-6-11(10)14(8)4/h5-7H,1H2,2-4H3 | | InChIKey | VDMXGJJMPKAYQP-UHFFFAOYSA-N | | SMILES | CN1C(=C)C(C)(C)c2cc(Cl)ccc12 | | CAS DataBase Reference | 6872-17-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Chloro-2-methylene-1,3,3-trimethylindoline Usage And Synthesis |
| Uses | 5-Chloro-2-methylene-1,3,3-trimethylindoline was used in the synthesis of 5′,6-dichloro-1′,3′,3′-trimethyl-spiro-[2H-1-benzopyran-2,2′-indoline]. | | General Description | 5-Chloro-2-methylene-1,3,3-trimethylindoline undergoes regiospecific 1,3-dipolar cycloaddition reaction with arylnitriloxydes and N-phenylarylnitrilimines. |
| | 5-Chloro-2-methylene-1,3,3-trimethylindoline Preparation Products And Raw materials |
|