|
|
| | Dehydro Simvastatin Basic information |
| Product Name: | Dehydro Simvastatin | | Synonyms: | 2,2-DiMethylbutanoic Acid (1S,3R,7S,8S,8aR)-8-[2-[(2R)-3,6-Dihydro-6-oxo-2H-pyran
-2-yl]ethyl]-1,2,3,7,8,8a-hexahydro-3,7-diMethyl-1-naphthalenyl Ester;SiMvastatin IMpurity-C;SiMvastatin EP IMpurity C;Anhydro SiMvastatin (SiMvastatin IMpurity C);(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-(2-((R)-6-oxo-5,6-dihydro-2H-pyran-2-yl)ethyl)-1,2,3,7,8,8a-hexahydronaphthalen-1-yl 2,2-dimethylbutanoate;SIMV-IM A;(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-(2-((R)-6-oxo-3,6-dihydro-2H-pyran-2-yl)ethyl)-1,2,3,7,8,8a-hexahydronaphthalen-1-yl 2,2-dimethylbutanoate;Simvastatin Impurity 3(Simvastatin EP Impurity C) | | CAS: | 210980-68-0 | | MF: | C25H36O4 | | MW: | 400.55 | | EINECS: | | | Product Categories: | Chiral Reagents;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 210980-68-0.mol |  |
| | Dehydro Simvastatin Chemical Properties |
| Melting point | 57 - 60°C | | Boiling point | 536.8±50.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly), Methan | | form | Oil | | color | Colourless to Pale Yellow | | Major Application | pharmaceutical (small molecule) | | InChIKey | BIYWBTKPNWCYHM-RLSQPJRHSA-N | | SMILES | O1[C@@H](CC=CC1=O)CC[C@@H]2[C@H]3[C@H](C[C@H](C=C3C=C[C@@H]2C)C)OC(=O)C(CC)(C)C |
| HS Code | 2932206000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 3 |
| | Dehydro Simvastatin Usage And Synthesis |
| Chemical Properties | Off-White Low Melting Solid | | Uses | Dehydro Simvastatin (Simvastatin EP Impurity C) is a Simvastatin (S485000) impurity. |
| | Dehydro Simvastatin Preparation Products And Raw materials |
|