| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Boc-L-pentafluorophenylalanine manufacturers
|
| | Boc-L-pentafluorophenylalanine Basic information |
| | Boc-L-pentafluorophenylalanine Chemical Properties |
| Boiling point | 411.1±45.0 °C(Predicted) | | density | 1.422±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.70±0.20(Predicted) | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | 1S/C14H14F5NO4/c1-14(2,3)24-13(23)20-6(12(21)22)4-5-7(15)9(17)11(19)10(18)8(5)16/h6H,4H2,1-3H3,(H,20,23)(H,21,22)/t6-/m0/s1 | | InChIKey | UZDKQMIDSLETST-LURJTMIESA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1c(F)c(F)c(F)c(F)c1F)C(O)=O | | CAS DataBase Reference | 34702-60-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Harmful/Irritant/Keep Cold | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | Boc-L-pentafluorophenylalanine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | BOC-L-Pentafluorophenylalanine is an intermediate used in the self-assembly of tripeptides into functional coating material that resists biofouling. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-L-pentafluorophenylalanine Preparation Products And Raw materials |
|