Pepper acid ethyl este manufacturers
- Pepper acid ethyl este
-
- $40.00 / 1kg
-
2025-06-20
- CAS:56019-71-7
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10 tons
- Pepper Acid Ethyl Este
-
- $1.00 / 100g
-
2024-08-15
- CAS:56019-71-7
- Min. Order: 10g
- Purity: 99%
- Supply Ability: 80000g
|
| | Pepper acid ethyl este Basic information |
| Product Name: | Pepper acid ethyl este | | Synonyms: | Pepper acid ethyl este;Piperinic acid ethyl ester;all-trans-5-(3,4-Methylendioxyphenyl)-2,4-pentadiensaeureethylester;Piperinsaeureaethylester;Ethyl piperate | | CAS: | 56019-71-7 | | MF: | C14H14O4 | | MW: | 246.25856 | | EINECS: | 251-228-4 | | Product Categories: | | | Mol File: | 56019-71-7.mol |  |
| | Pepper acid ethyl este Chemical Properties |
| Melting point | 76-77℃ (ethyl ether hexane ) | | InChI | InChI=1S/C14H14O4/c1-2-16-14(15)6-4-3-5-11-7-8-12-13(9-11)18-10-17-12/h3-9H,2,10H2,1H3/b5-3+,6-4+ | | InChIKey | KQDXOQJALDYLMO-GGWOSOGESA-N | | SMILES | C(OCC)(=O)/C=C/C=C/C1=CC=C2OCOC2=C1 |
| | Pepper acid ethyl este Usage And Synthesis |
| | Pepper acid ethyl este Preparation Products And Raw materials |
|