| Company Name: |
Aoxuan Biological Technology Co., Ltd.
|
| Tel: |
17073140108 |
| Email: |
|
| Products Intro: |
Product Name:3CMC 3-Chloromethcathinone (hydrochloride)
CAS:1607439-32-6
Purity:99.8% Package:25g/aluminum foil bag,$50/bag Remarks:Appearance:powder Purity:99.8% Package: 1kg/Aluminum foil bag Storage: Kept in a cool, dry and ventilated Application: For chemical research cherry@hebeiaoxuan.com
|
| Company Name: |
Conier Chem & Pharma Limited
|
| Tel: |
13368167990 |
| Email: |
sales@conier.com |
| Products Intro: |
CAS:1607439-32-6
Purity:99% HPLC Package:5KG;1KG
|
| Company Name: |
ChemeGen(Shanghai) Biotechnology Co.,Ltd.
|
| Tel: |
18818260767 |
| Email: |
sales@chemegen.com |
| Products Intro: |
Product Name:3-Chloromethcathinone hydrochloride
CAS:1607439-32-6
Purity:98% Package:10 mg;50 mg;100 mg;500 mg;1 g;5 g;10 g
|
3-Chloromethcathinone Hydrochloride manufacturers
|
| | 3-Chloromethcathinone Hydrochloride Basic information |
| | 3-Chloromethcathinone Hydrochloride Chemical Properties |
| form | A neat solid | | InChI | InChI=1S/C10H12ClNO.ClH/c1-7(12-2)10(13)8-4-3-5-9(11)6-8;/h3-7,12H,1-2H3;1H | | InChIKey | QXEPSICDXPPHTO-UHFFFAOYSA-N | | SMILES | C(C1C=CC=C(Cl)C=1)(=O)C(C)NC.Cl |
| | 3-Chloromethcathinone Hydrochloride Usage And Synthesis |
| Uses | 1-(3-Chlorophenyl)-2-(methylamino)-1-propanone is used to prepare hybrid dopamine reuptake inhibitors that display serotonin releasing activities. |
| | 3-Chloromethcathinone Hydrochloride Preparation Products And Raw materials |
|