| Company Name: |
Shaanxi Dideu Newmaterial Co., Ltd.
|
| Tel: |
029-63373950 17392213970 |
| Email: |
1052@dideu.com |
| Products Intro: |
Product Name:(Z)-3,4-dimethylhex-3-ene
CAS:19550-87-9
Purity:98% Package:25KG
|
|
| | CIS-3,4-DIMETHYL-3-HEXENE Basic information |
| Product Name: | CIS-3,4-DIMETHYL-3-HEXENE | | Synonyms: | (3Z)-3,4-Dimethyl-3-hexene;CIS-3,4-DIMETHYL-3-HEXENE;(Z)-3,4-dimethyl-3-hexene;(Z)-3,4-Dimethylhex-2-ene;(Z)-3,4-Dimethylhex-3-ene;(Z)-C2H5C(CH3)=C(CH3)C2H5;2-Hexene, 3,4-dimethyl, cis;3-Hexene, 3,4-dimethyl-, (Z)- | | CAS: | 19550-87-9 | | MF: | C8H16 | | MW: | 112.21 | | EINECS: | 243-157-2 | | Product Categories: | | | Mol File: | 19550-87-9.mol |  |
| | CIS-3,4-DIMETHYL-3-HEXENE Chemical Properties |
| Melting point | -103.01°C (estimate) | | Boiling point | 120.2°C (estimate) | | density | 0.7430 | | refractive index | 1.4280 | | InChI | InChI=1S/C8H16/c1-5-7(3)8(4)6-2/h5-6H2,1-4H3/b8-7- | | InChIKey | XTUXVDJHGIEBAA-FPLPWBNLSA-N | | SMILES | CC/C(/C)=C(/C)\CC |
| | CIS-3,4-DIMETHYL-3-HEXENE Usage And Synthesis |
| | CIS-3,4-DIMETHYL-3-HEXENE Preparation Products And Raw materials |
|