OPHTHALMIC ACID manufacturers
- Ophthalmic acid
-
- $159.00 / 5mg
-
2026-04-20
- CAS:495-27-2
- Min. Order:
- Purity:
- Supply Ability: 10g
- OPHTHALMIC ACID
-
- $30.00 / 1KG
-
2025-12-12
- CAS:495-27-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 6000KG
|
| | OPHTHALMIC ACID Basic information |
| Product Name: | OPHTHALMIC ACID | | Synonyms: | OPHTHALMIC ACID;H-GAMMA-GLU-ABU-GLY-OH;H-GLU(ABU-GLY-OH)-OH;GLU(ABU-GLY-OH)-OH;(2S)-2-amino-4-[[(2S)-2-aminobutanoyl]-(carboxymethyl)carbamoyl]butanoic acid;L-γGlu-L-Abu-Gly-OH;N-[(2S)-2-[(γGlu-)Amino]butyryl]glycine;N-[(S)-α-(L-γ-Glutamylamino)butyryl]glycine | | CAS: | 495-27-2 | | MF: | C11H19N3O6 | | MW: | 289.29 | | EINECS: | | | Product Categories: | | | Mol File: | 495-27-2.mol |  |
| | OPHTHALMIC ACID Chemical Properties |
| Melting point | 177-179 °C (decomp) | | Boiling point | 712.2±60.0 °C(Predicted) | | density | 1.341±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | solubility | DMF: 5 mg/ml; DMSO: 5 mg/ml; Ethanol: 12 mg/ml; PBS (pH 7.2): 3 mg/ml | | form | Solid | | pka | 2.22±0.10(Predicted) | | color | White to off-white | | Major Application | clinical testing | | InChI | 1S/C11H19N3O6/c1-2-7(10(18)13-5-9(16)17)14-8(15)4-3-6(12)11(19)20/h6-7H,2-5,12H2,1H3,(H,13,18)(H,14,15)(H,16,17)(H,19,20)/t6-,7-/m0/s1 | | InChIKey | JCMUOFQHZLPHQP-BQBZGAKWSA-N | | SMILES | N([C@@H](CC)C(=O)NCC(=O)O)C(=O)CC[C@H](N)C(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | OPHTHALMIC ACID Usage And Synthesis |
| Uses | Ophthalmic Acid is used in the composition and method for enhancing cooling sensation of food and beverage, and flavor composition. | | Definition | ChEBI: A L-glutamine derivative that is L-glutamine substituted by a 1-[(carboxymethyl)amino]-1-oxobutan-2-yl at the terminal amino nitrogen atom. | | Biological Activity | Ophthamalic acid is an analogue of glutathione isolated from crystalline lens. Ophthalmic acid could be used as a biomarker in oxidative stress. Ophthalmic acid belongs to the class of organic compounds known as gamma-glutamyl peptides. These are oligo- and polypeptides consisting of any C-terminal alpha peptide having a gamma-glutamyl residue attached at the N alpha-position. |
| | OPHTHALMIC ACID Preparation Products And Raw materials |
|