| Company Name: |
Shanghai Aladdin Bio-Chem Technology Co.,LTD
|
| Tel: |
400-6206333 13167063860 |
| Email: |
anhua.mao@aladdin-e.com |
| Products Intro: |
Product Name:Imidacloprid-d4 CAS:1015855-75-0 Purity:≥95% Package:1mg/RMB 999.90;5mg/RMB 2999.90;10mg/RMB 4799.90
|
| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:IMidacloprid D4 (iMidazolidin-4,4,5,5 D4) CAS:1015855-75-0 Purity:98% 10Mg 25Mg 100Mg
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Imidacloprid D4 (imidazolidin-4,4,5,5 D4) CAS:1015855-75-0 Purity:99% Package:10mg,100mg
|
|
| | IMIDACLOPRID D4 (IMIDAZOLIDIN-4,4,5,5 D4) Basic information |
| Product Name: | IMIDACLOPRID D4 (IMIDAZOLIDIN-4,4,5,5 D4) | | Synonyms: | IMIDACLOPRID D4 (IMIDAZOLIDIN-4,4,5,5 D4);1-[(6-Chloro-3-pyridinyl)methyl]-4,5-dihydro-4,5-d2-N-nitro-1H-imidazol-4,5-d2-2-amine;Imidacloprid-d4;N-[1-[(6-chloropyridin-3-yl)methyl]-4,4,5,5-tetradeuterioimidazol-2-yl]nitramide;D4-Imidacloprid;[2H4]-Imidacloprid;Imidacloprid-d4 (imidazolidine-4,4,5,5-d4) in acetonitrile;Imidacloprid D4 (imidazolidin-4,4,5,5 D4) 100 μg/mL in Acetone | | CAS: | 1015855-75-0 | | MF: | C9H10ClN5O2 | | MW: | 255.66 | | EINECS: | | | Product Categories: | | | Mol File: | 1015855-75-0.mol |  |
| | IMIDACLOPRID D4 (IMIDAZOLIDIN-4,4,5,5 D4) Chemical Properties |
| solubility | Acetonitrile (Slightly), DMSO (Slightly), Methanol (Slightly) | | Major Application | agriculture environmental | | InChI | 1S/C9H10ClN5O2/c10-8-2-1-7(5-12-8)6-14-4-3-11-9(14)13-15(16)17/h1-2,5H,3-4,6H2,(H,11,13)/i3D2,4D2 | | InChIKey | YWTYJOPNNQFBPC-KHORGVISSA-N | | SMILES | [2H]C1([2H])N=C(N[N+]([O-])=O)N(Cc2ccc(Cl)nc2)C1([2H])[2H] | | EPA Substance Registry System | Imidacloprid-d4 (1015855-75-0) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | IMIDACLOPRID D4 (IMIDAZOLIDIN-4,4,5,5 D4) Usage And Synthesis |
| Uses | Imidacloprid-d4 is labelled Imidacloprid which is a neonicotinoid, the active ingredient in certain neuro-active insecticides. Intended for use as an internal standard for the quantification of Imidacloprid by GC- or LC-mass spectrometry |
| | IMIDACLOPRID D4 (IMIDAZOLIDIN-4,4,5,5 D4) Preparation Products And Raw materials |
|