| Company Name: |
S.Z. PhyStandard Bio-Tech. Co., Ltd.
|
| Tel: |
0755-4000505016 13380397412 |
| Email: |
3001272453@qq.com |
| Products Intro: |
Product Name:Faropenem Impurity 13
CAS:613670-77-2
Purity:98%HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Faropenem Impurity 39
CAS:613670-77-2
Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:Faropenem Impurity 13
CAS:613670-77-2
Purity:>95%
|
Faropenem Impurity manufacturers
- Faroenem Impurity
-
- $0.00 / 10mg
-
2025-07-31
- CAS:613670-77-2
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 100000
|
| | Faropenem Impurity Basic information |
| Product Name: | Faropenem Impurity | | Synonyms: | Faropenem Impurity 1Q: What is
Faropenem Impurity 1 Q: What is the CAS Number of
Faropenem Impurity 1;(R)-5-(Tetrahydrofuran-2-yl)thiazole-4-carboxylic Acid;Faropenem Impurity A;4-Thiazolecarboxylic acid, 5-[(2R)-tetrahydro-2-furanyl]-;Faropenem Impurity C;Faropenem finished product impurity 4 | | CAS: | 613670-77-2 | | MF: | C8H9NO3S | | MW: | 199.22 | | EINECS: | | | Product Categories: | | | Mol File: | 613670-77-2.mol |  |
| | Faropenem Impurity Chemical Properties |
| Boiling point | 377.2±42.0 °C(Predicted) | | density | 1.431±0.06 g/cm3(Predicted) | | pka | 3.30±0.10(Predicted) | | InChI | InChI=1/C8H9NO3S/c10-8(11)6-7(13-4-9-6)5-2-1-3-12-5/h4-5H,1-3H2,(H,10,11)/t5-/s3 | | InChIKey | XZUWAHCIQCKWFP-GQMHJJTINA-N | | SMILES | C(C1N=CSC=1[C@@H]1OCCC1)(=O)O |&1:6,r| |
| | Faropenem Impurity Usage And Synthesis |
| | Faropenem Impurity Preparation Products And Raw materials |
|