| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Boc-3,5-diiodo-Tyr-OSu Basic information |
| Product Name: | Boc-3,5-diiodo-Tyr-OSu | | Synonyms: | BOC-3,5-DIIODO-L-TYROSINE N-HYDROXYSUCCINIMIDE ESTER;BOC-3,5-DIIODO-TYROSINE-OSU;Boc-3,5-diiodo-L-tyrosineN-hydroxysuccinimide ester≥ 98% (HPLC);Boc-3,5-diiodo-L-Tyr-OSu;boc-tyr(3,5-i2)-osu;(S)-2,5-Dioxopyrrolidin-1-yl 2-((tert-butoxycarbonyl)aMino)-3-(4-hydroxy-3,5-diiodophenyl)propanoate;BOC-3,5-DIIODO-L-TYROSINE HYDROXYSUCCINIMIDE ESTER;L-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-3,5-diiodo-, 2,5-dioxo-1-pyrrolidinyl ester | | CAS: | 163679-35-4 | | MF: | C18H20I2N2O7 | | MW: | 630.17 | | EINECS: | | | Product Categories: | | | Mol File: | 163679-35-4.mol |  |
| | Boc-3,5-diiodo-Tyr-OSu Chemical Properties |
| Melting point | 144-148 °C | | density | 1.97±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 6.87±0.25(Predicted) | | Optical Rotation | [α]20/D +17±1°, c = 1% in chloroform | | Major Application | peptide synthesis | | InChI | 1S/C18H20I2N2O7/c1-18(2,3)28-17(27)21-12(8-9-6-10(19)15(25)11(20)7-9)16(26)29-22-13(23)4-5-14(22)24/h6-7,12,25H,4-5,8H2,1-3H3,(H,21,27)/t12-/m0/s1 | | InChIKey | OOTFAHIVGAQXOL-LBPRGKRZSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cc(I)c(O)c(I)c1)C(=O)ON2C(=O)CCC2=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8-10-21 | | Storage Class | 11 - Combustible Solids |
| | Boc-3,5-diiodo-Tyr-OSu Usage And Synthesis |
| Chemical Properties | Yellow powder | | Uses | Boc-Tyr(3,5-I2)-OSu (CAS# 163679-35-4) is a boc-protectected amino acid used in the synthesis of peptides and peptide fragments, such as analogs of α-factor, the Saccharomyces cerevisiae tridecapeptide mating pheromone. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-3,5-diiodo-Tyr-OSu Preparation Products And Raw materials |
|