|
|
| | 2-ACETYL-4-CHLOROTHIOPHENE Basic information |
| Product Name: | 2-ACETYL-4-CHLOROTHIOPHENE | | Synonyms: | 2-ACETYL-4-CHLOROTHIOPHENE;1-(4-chlorothien-2-yl)ethanone;2-Acetyl-4-chlorothiophene, 98;1-(4-Chlorothiophen-2-yl)ethanone;Ethanone, 1-(4-chloro-2-thienyl)-;2-acetyl-4-chlopothiophene;4-chloro-2-acetothiophene;Avatrombopag Impurity 26 | | CAS: | 34730-20-6 | | MF: | C6H5ClOS | | MW: | 160.62 | | EINECS: | 677-855-7 | | Product Categories: | Sulfur compounds;Intermediate | | Mol File: | 34730-20-6.mol |  |
| | 2-ACETYL-4-CHLOROTHIOPHENE Chemical Properties |
| Boiling point | 263.0±25.0 °C(Predicted) | | density | 1.334 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | InChI | InChI=1S/C6H5ClOS/c1-4(8)6-2-5(7)3-9-6/h2-3H,1H3 | | InChIKey | FKESGQASARHBDC-UHFFFAOYSA-N | | SMILES | C(=O)(C1SC=C(Cl)C=1)C |
| Risk Statements | 36 | | Safety Statements | 26 | | RIDADR | UN2810 | | HazardClass | 6.1 | | HS Code | 2934999090 |
| | 2-ACETYL-4-CHLOROTHIOPHENE Usage And Synthesis |
| Description | 2-Acetyl-4-chlorothiophene is an oxychloride that belongs to the family of thiourea derivatives. It is synthesized by reacting phosphorus oxychloride with 2,3-dichloroacetophenone in a solvent such as dioxane or acetonitrile. The final product is purified by means of vacuum distillation and recrystallization from diethyl ether, hexane, and chlorinated hydrocarbons. |
| | 2-ACETYL-4-CHLOROTHIOPHENE Preparation Products And Raw materials |
|