|
|
| | Triethylammonium phosphate Basic information |
| Product Name: | Triethylammonium phosphate | | Synonyms: | n,n-diethyl-ethanaminphosphate(1:1);PHOSPHORIC ACID:TRIETHYLAMINE 2M:1M;PHOSPHORIC ACID:TRIETHYLAMINE 2M:2M;TRIETHYLAMINE PHOSPHATE;TRIETHYLAMINE:PHOSPHORIC ACID 1M:2M;TRIETHYLAMINE:PHOSPHORIC ACID 2M:2M;triethylammonium dihydrogen phosphate;PHOSPHORIC ACID:TRIETHYLAMINE 2M:2M CONC ENTRATE, IN WATER | | CAS: | 35365-94-7 | | MF: | C6H18NO4P | | MW: | 199.19 | | EINECS: | 252-528-8 | | Product Categories: | | | Mol File: | 35365-94-7.mol |  |
| | Triethylammonium phosphate Chemical Properties |
| Melting point | 93 °C | | density | 1.09 g/mL at 20 °C | | refractive index | n20/D 1.360 | | storage temp. | Inert atmosphere,Room Temperature | | Water Solubility | Soluble in water | | form | powder to crystal | | color | Clear | | PH | 2.9-3.1 (25°C) | | InChI | 1S/C6H15N.H3O4P/c1-4-7(5-2)6-3;1-5(2,3)4/h4-6H2,1-3H3;(H3,1,2,3,4) | | InChIKey | UNXNGGMLCSMSLH-UHFFFAOYSA-N | | SMILES | OP(O)(O)=O.OP(O)(O)=O.CCN(CC)CC | | EPA Substance Registry System | Triethylamine phosphate (1:1) (35365-94-7) |
| Hazard Codes | Xi | | Risk Statements | 36/38-36/37/38 | | Safety Statements | 26-45-36/37/39 | | RIDADR | UN 1805 8/PG 3 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 2921.19.1100 | | Storage Class | 10 - Combustible liquids |
| | Triethylammonium phosphate Usage And Synthesis |
| Uses | Triethylammonium phosphate solution may be used as a mobile phase additive for toxicological drug screening by high-performance liquid chromatography (HPLC) and as an elution buffer in HPLC separation of DL-amino acids. | | Biological Activity | Triethylammonium phosphate (TEAP) buffers are highly efficient solvents, th at can be used for reversed-phase high-performance liquid chromatography (RP-HPLC). |
| | Triethylammonium phosphate Preparation Products And Raw materials |
|