| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Ethyl 4-hydroxy-7-(trifluoromethyl)quinoline-3-carboxylate Basic information |
| Product Name: | Ethyl 4-hydroxy-7-(trifluoromethyl)quinoline-3-carboxylate | | Synonyms: | ETHYL 4-HYDROXY-7-TRIFLUOROMETHYL-3-QUINOLINECARBOXYLATE;BUTTPARK 21\09-47;ethyl 4-hydroxy-7-trifluoromethyl-3-quinolinecarb;4-Hydroxy-7-(trifluoromethyl)-3-quinolinecarboxylic acid ethyl ester;4-keto-7-(trifluoromethyl)-1H-quinoline-3-carboxylic acid ethyl ester;ethyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-3-carboxylate;3-Quinolinecarboxylic acid, 4-hydroxy-7-(trifluoromethyl)-, ethyl ester;4-oxo-7-(trifluoromethyl)-1H-quinoline-3-carboxylic acid ethyl ester | | CAS: | 391-02-6 | | MF: | C13H10F3NO3 | | MW: | 285.22 | | EINECS: | 206-871-5 | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Quinolines | | Mol File: | 391-02-6.mol |  |
| | Ethyl 4-hydroxy-7-(trifluoromethyl)quinoline-3-carboxylate Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 343.5±37.0 °C(Predicted) | | density | 1.404±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder | | pka | 2.11±0.50(Predicted) | | color | Off-white | | InChI | 1S/C13H10F3NO3/c1-2-20-12(19)9-6-17-10-5-7(13(14,15)16)3-4-8(10)11(9)18/h3-6H,2H2,1H3,(H,17,18) | | InChIKey | YHUWNMJUAZJACG-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cnc2cc(ccc2c1O)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Ethyl 4-hydroxy-7-(trifluoromethyl)quinoline-3-carboxylate Usage And Synthesis |
| Uses | Ethyl 4-Hydroxy-7-(trifluoromethyl)quinoline-3-carboxylate (CAS# 391-02-6) can be used as a potent antimicrobial agent. It can also be prepared as TRPV1 antagonist for therapy. | | General Description | Ethyl 4-hydroxy-7-trifluoromethyl-3-quinolinecarboxylate, a heterocyclic building block, is a quinoline derivative.These derivatives have antiseptic, antipyretic and antiperiodic action and possess various pharmacological applications. |
| | Ethyl 4-hydroxy-7-(trifluoromethyl)quinoline-3-carboxylate Preparation Products And Raw materials |
|