| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Bromo-4-fluorobenzenesulfonamide Basic information |
| | 2-Bromo-4-fluorobenzenesulfonamide Chemical Properties |
| Melting point | 171-175 °C(lit.) | | Boiling point | 360.9±52.0 °C(Predicted) | | density | 1.830±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 9.57±0.60(Predicted) | | InChI | InChI=1S/C6H5BrFNO2S/c7-5-3-4(8)1-2-6(5)12(9,10)11/h1-3H,(H2,9,10,11) | | InChIKey | FEUDPWHDKUOLBW-UHFFFAOYSA-N | | SMILES | C1(S(N)(=O)=O)=CC=C(F)C=C1Br | | CAS DataBase Reference | 351003-60-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2935909099 |
| | 2-Bromo-4-fluorobenzenesulfonamide Usage And Synthesis |
| | 2-Bromo-4-fluorobenzenesulfonamide Preparation Products And Raw materials |
|