| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Email: |
2853979817@qq.com |
| Products Intro: |
Product Name:Benzo[c]thiophene-1,3-dicarboxylic acid
CAS:49680-18-4
Purity:98% Package:100mg；250mg；500mg；1g；5g；10g；25g；50g；100g；250g；500g；1kg；5kg；10kg；25kg
|
|
| | Benzo[c]thiophene-1,3-dicarboxylic acid Basic information |
| | Benzo[c]thiophene-1,3-dicarboxylic acid Chemical Properties |
| Boiling point | 534.1±35.0 °C(Predicted) | | density | 1.609±0.06 g/cm3(Predicted) | | pka | 2.55±0.10(Predicted) | | InChI | InChI=1S/C10H6O4S/c11-9(12)7-5-3-1-2-4-6(5)8(15-7)10(13)14/h1-4H,(H,11,12)(H,13,14) | | InChIKey | VIIFFBXXSFBBTR-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)SC(C(O)=O)=C2C=CC=CC=12 |
| | Benzo[c]thiophene-1,3-dicarboxylic acid Usage And Synthesis |
| | Benzo[c]thiophene-1,3-dicarboxylic acid Preparation Products And Raw materials |
|