|
|
| | (E)-4-methyl-2-(pent-1-enyl)-1,3-dioxolane Basic information |
| Product Name: | (E)-4-methyl-2-(pent-1-enyl)-1,3-dioxolane | | Synonyms: | (E)-4-methyl-2-(pent-1-enyl)-1,3-dioxolane;(+/-)-TRANS- AND CIS-2-HEXENAL PROPYLENE GLYCOL ACETAL;4-Methyl-2-[(E)-1-pentenyl]-1,3-dioxolane;trans-2-Hexenal propyleneglycol acetal;Trans-2-hexenal P.G Acetal;Trans-2-Hexenyl Pg Acetal;1,3-Dioxolane, 4-methyl-2-(1E)-1-penten-1-yl-;Trans-2-hexenal P.G.A | | CAS: | 94089-21-1 | | MF: | C9H16O2 | | MW: | 156.22 | | EINECS: | 302-121-7 | | Product Categories: | | | Mol File: | 94089-21-1.mol |  |
| | (E)-4-methyl-2-(pent-1-enyl)-1,3-dioxolane Chemical Properties |
| Boiling point | 185.3±25.0 °C(Predicted) | | density | 0.978±0.06 g/cm3(Predicted) | | FEMA | 4272 | (+/-)-TRANS- AND CIS-2-HEXENAL PROPYLENE GLYCOL ACETAL | | Odor | at 100.00 %. mild green fruity apple | | Odor Type | green | | JECFA Number | 1801 | | InChI | InChI=1S/C9H16O2/c1-3-4-5-6-9-10-7-8(2)11-9/h5-6,8-9H,3-4,7H2,1-2H3/b6-5+ | | InChIKey | WMWBRDXHCMVBJG-AATRIKPKSA-N | | SMILES | O1CC(C)OC1/C=C/CCC | | LogP | 2.174 (est) |
| | (E)-4-methyl-2-(pent-1-enyl)-1,3-dioxolane Usage And Synthesis |
| Chemical Properties | Liquid; weak green and fresh aroma. | | Aroma threshold values | Medium strength odor, mild green, fruity apple type |
| | (E)-4-methyl-2-(pent-1-enyl)-1,3-dioxolane Preparation Products And Raw materials |
|